C8H15ClO6 — CID 141175486
(3R,4S,5S,6R)-2-(2-chloro-2-deuterioethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 141175486) has the molecular formula C8H15ClO6 and a molecular weight of 243.66 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-(2-chloro-2-deuterioethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-2-(2-chloro-2-deuterioethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 141175486 |
| Molecular Formula | C8H15ClO6 |
| Molecular Weight | 243.66 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (3R,4S,5S,6R)-2-(2-chloro-2-deuterioethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | [2H]C(Cl)CC1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15ClO6/c9-2-1-8(14)7(13)6(12)5(11)4(3-10)15-8/h4-7,10-14H,1-3H2/t4-,5-,6+,7-,8?/m1/s1/i2D/t2?,4-,5-,6+,7-,8? |
| InChIKey | BWGLKMQOONBGLM-AQRHPCCXSA-N |
| XLogP | -2.22 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.66 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|