C8H13BO4 — CID 88533408
CID 88533408 (PubChem CID 88533408) has the molecular formula C8H13BO4 and a molecular weight of 184.00 g/mol.
| Compound Name | CID 88533408 |
|---|---|
| PubChem CID | 88533408 |
| Molecular Formula | C8H13BO4 |
| Molecular Weight | 184.00 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | — |
| SMILES | [B]C1OC(CO)[C@@H](O)[C@]1(O)CC=C |
| InChI | InChI=1S/C8H13BO4/c1-2-3-8(12)6(11)5(4-10)13-7(8)9/h2,5-7,10-12H,1,3-4H2/t5?,6-,7?,8-/m1/s1 |
| InChIKey | GBTJZAFLUHLZNY-WMEPKMGJSA-N |
| XLogP | -1.46 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.00 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|