C6H12O7 — CID 134812037
(2S,3S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,4,5-pentol (PubChem CID 134812037) has the molecular formula C6H12O7 and a molecular weight of 196.15 g/mol. Its IUPAC name is (2S,3S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,4,5-pentol.
| Compound Name | (2S,3S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,4,5-pentol |
|---|---|
| PubChem CID | 134812037 |
| Molecular Formula | C6H12O7 |
| Molecular Weight | 196.15 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (2S,3S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,4,5-pentol |
| SMILES | OC[C@H]1O[C@H](O)[C@H](O)C(O)(O)[C@@H]1O |
| InChI | InChI=1S/C6H12O7/c7-1-2-3(8)6(11,12)4(9)5(10)13-2/h2-5,7-12H,1H2/t2-,3-,4+,5+/m1/s1 |
| InChIKey | UBGFFTONZAIFLW-MBMOQRBOSA-N |
| XLogP | -3.90 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.15 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|