C15H19N5O4 — CID 121478616
(3R)-2-(2-amino-6-ethenylpurin-9-yl)-5-(hydroxymethyl)-3-prop-2-enyloxolane-3,4-diol (PubChem CID 121478616) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is (3R)-2-(2-amino-6-ethenylpurin-9-yl)-5-(hydroxymethyl)-3-prop-2-enyloxolane-3,4-diol.
| Compound Name | (3R)-2-(2-amino-6-ethenylpurin-9-yl)-5-(hydroxymethyl)-3-prop-2-enyloxolane-3,4-diol |
|---|---|
| PubChem CID | 121478616 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (3R)-2-(2-amino-6-ethenylpurin-9-yl)-5-(hydroxymethyl)-3-prop-2-enyloxolane-3,4-diol |
| SMILES | C=CC[C@@]1(O)C(O)C(CO)OC1n1cnc2c(C=C)nc(N)nc21 |
| InChI | InChI=1S/C15H19N5O4/c1-3-5-15(23)11(22)9(6-21)24-13(15)20-7-17-10-8(4-2)18-14(16)19-12(10)20/h3-4,7,9,11,13,21-23H,1-2,5-6H2,(H2,16,18,19)/t9?,11?,13?,15-/m1/s1 |
| InChIKey | HRGLWKOGNMMIPB-PULWUANESA-N |
| XLogP | -0.39 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|