C10H13N3O5 — CID 14842983
N-[[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]formamide (PubChem CID 14842983) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is N-[[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]formamide.
| Compound Name | N-[[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 14842983 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]formamide |
| SMILES | O=CNC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C10H13N3O5/c14-5-11-4-7-6(15)3-9(18-7)13-2-1-8(16)12-10(13)17/h1-2,5-7,9,15H,3-4H2,(H,11,14)(H,12,16,17)/t6-,7+,9+/m0/s1 |
| InChIKey | CRHOHOMAUYAONM-LKEWCRSYSA-N |
| XLogP | -2.07 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|