C13H18N4O4 — CID 121487473
(E)-2-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylamino]but-2-enal (PubChem CID 121487473) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is (E)-2-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylamino]but-2-enal.
| Compound Name | (E)-2-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylamino]but-2-enal |
|---|---|
| PubChem CID | 121487473 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (E)-2-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylamino]but-2-enal |
| SMILES | C/C=C(\C=O)NC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1N |
| InChI | InChI=1S/C13H18N4O4/c1-2-8(7-18)15-6-10-9(14)5-12(21-10)17-4-3-11(19)16-13(17)20/h2-4,7,9-10,12,15H,5-6,14H2,1H3,(H,16,19,20)/b8-2+/t9-,10+,12+/m0/s1 |
| InChIKey | IKPMBBAYDJLJSU-WFHSBBPCSA-N |
| XLogP | -1.16 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|