C51H85NO10P+ — CID 10147676
2-[[(2R,3R,4R,5R)-3,4-bis[[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]oxy]-5-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 10147676) has the molecular formula C51H85NO10P+ and a molecular weight of 903.21 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5R)-3,4-bis[[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]oxy]-5-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R,3R,4R,5R)-3,4-bis[[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]oxy]-5-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 10147676 |
| Molecular Formula | C51H85NO10P+ |
| Molecular Weight | 903.21 g/mol |
| Exact Mass | 902.59 |
| IUPAC Name | 2-[[(2R,3R,4R,5R)-3,4-bis[[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]oxy]-5-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)O[C@H]1[C@H](OC)O[C@H](COP(=O)(O)OCC[N+](C)(C)C)[C@H]1OC(=O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C51H84NO10P/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-47(53)61-49-46(45-59-63(55,56)58-44-43-52(3,4)5)60-51(57-6)50(49)62-48(54)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h15-18,21-24,27-30,33-36,46,49-51H,7-14,19-20,25-26,31-32,37-45H2,1-6H3/p+1/b17-15+,18-16+,23-21+,24-22+,29-27+,30-28+,35-33+,36-34+/t46-,49-,50-,51-/m1/s1 |
| InChIKey | SBRPRGAWMWIKMW-KUTOXPNESA-O |
| XLogP | 12.31 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.21 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|