C47H79N3O6 — CID 177280067
1-[(2R,3S,5R)-5-[[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]oxymethyl]-4-hydroxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 177280067) has the molecular formula C47H79N3O6 and a molecular weight of 782.16 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-5-[[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]oxymethyl]-4-hydroxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,5R)-5-[[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]oxymethyl]-4-hydroxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177280067 |
| Molecular Formula | C47H79N3O6 |
| Molecular Weight | 782.16 g/mol |
| Exact Mass | 781.60 |
| IUPAC Name | 1-[(2R,3S,5R)-5-[[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]oxymethyl]-4-hydroxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)=NOC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](OC)C1O |
| InChI | InChI=1S/C47H79N3O6/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2)49-55-40-42-44(52)45(54-3)46(56-42)50-39-38-43(51)48-47(50)53/h12-15,18-21,38-39,42,44-46,52H,4-11,16-17,22-37,40H2,1-3H3,(H,48,51,53)/b14-12-,15-13-,20-18-,21-19-/t42-,44?,45+,46-/m1/s1 |
| InChIKey | KRRSPDOMPWVDDL-VCTHCHNTSA-N |
| XLogP | 11.59 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.16 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|