C26H34N4O9S — CID 166790782
[3-acetyloxy-6-[(3R,4R,5S)-4-acetyloxy-5-(4-phenyltriazol-1-yl)oxan-3-yl]sulfanyl-4-amino-5-methoxyoxan-2-yl]methyl acetate (PubChem CID 166790782) has the molecular formula C26H34N4O9S and a molecular weight of 578.64 g/mol. Its IUPAC name is [3-acetyloxy-6-[(3R,4R,5S)-4-acetyloxy-5-(4-phenyltriazol-1-yl)oxan-3-yl]sulfanyl-4-amino-5-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-[(3R,4R,5S)-4-acetyloxy-5-(4-phenyltriazol-1-yl)oxan-3-yl]sulfanyl-4-amino-5-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 166790782 |
| Molecular Formula | C26H34N4O9S |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | [3-acetyloxy-6-[(3R,4R,5S)-4-acetyloxy-5-(4-phenyltriazol-1-yl)oxan-3-yl]sulfanyl-4-amino-5-methoxyoxan-2-yl]methyl acetate |
| SMILES | COC1C(S[C@@H]2COC[C@H](n3cc(-c4ccccc4)nn3)[C@H]2OC(C)=O)OC(COC(C)=O)C(OC(C)=O)C1N |
| InChI | InChI=1S/C26H34N4O9S/c1-14(31)36-12-20-24(38-16(3)33)22(27)25(34-4)26(39-20)40-21-13-35-11-19(23(21)37-15(2)32)30-10-18(28-29-30)17-8-6-5-7-9-17/h5-10,19-26H,11-13,27H2,1-4H3/t19-,20?,21+,22?,23+,24?,25?,26?/m0/s1 |
| InChIKey | QHSAGILHZSYFHC-NYACQSMBSA-N |
| XLogP | 1.11 |
| TPSA | 163.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|