C30H51N3O11 — CID 102336419
[2-methyl-2-(octanoyloxymethyl)-3-oxo-3-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methoxy]propyl] octanoate (PubChem CID 102336419) has the molecular formula C30H51N3O11 and a molecular weight of 629.75 g/mol. Its IUPAC name is [2-methyl-2-(octanoyloxymethyl)-3-oxo-3-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methoxy]propyl] octanoate.
| Compound Name | [2-methyl-2-(octanoyloxymethyl)-3-oxo-3-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methoxy]propyl] octanoate |
|---|---|
| PubChem CID | 102336419 |
| Molecular Formula | C30H51N3O11 |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | [2-methyl-2-(octanoyloxymethyl)-3-oxo-3-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methoxy]propyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(C)(COC(=O)CCCCCCC)C(=O)OCc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C30H51N3O11/c1-4-6-8-10-12-14-23(35)42-19-30(3,20-43-24(36)15-13-11-9-7-5-2)29(40)41-18-21-16-33(32-31-21)28-27(39)26(38)25(37)22(17-34)44-28/h16,22,25-28,34,37-39H,4-15,17-20H2,1-3H3/t22-,25-,26+,27-,28-/m1/s1 |
| InChIKey | HICKBVMASWPETQ-FSKOWZIRSA-N |
| XLogP | 2.11 |
| TPSA | 199.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|