C14H24N4O7 — CID 46862175
tert-butyl N-[[1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methyl]carbamate (PubChem CID 46862175) has the molecular formula C14H24N4O7 and a molecular weight of 360.37 g/mol. Its IUPAC name is tert-butyl N-[[1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 46862175 |
| Molecular Formula | C14H24N4O7 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | tert-butyl N-[[1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn([C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C14H24N4O7/c1-14(2,3)25-13(23)15-4-7-5-18(17-16-7)12-11(22)10(21)9(20)8(6-19)24-12/h5,8-12,19-22H,4,6H2,1-3H3,(H,15,23)/t8-,9-,10+,11-,12+/m1/s1 |
| InChIKey | LXWGDVGZEUOPAY-ZIQFBCGOSA-N |
| XLogP | -1.72 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |