C16H20N4O7 — CID 71497036
[1-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methyl 2-aminobenzoate (PubChem CID 71497036) has the molecular formula C16H20N4O7 and a molecular weight of 380.36 g/mol. Its IUPAC name is [1-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methyl 2-aminobenzoate.
| Compound Name | [1-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methyl 2-aminobenzoate |
|---|---|
| PubChem CID | 71497036 |
| Molecular Formula | C16H20N4O7 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [1-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methyl 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OCc1cn([C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)nn1 |
| InChI | InChI=1S/C16H20N4O7/c17-10-4-2-1-3-9(10)16(25)26-7-8-5-20(19-18-8)15-14(24)13(23)12(22)11(6-21)27-15/h1-5,11-15,21-24H,6-7,17H2/t11-,12-,13+,14+,15+/m1/s1 |
| InChIKey | OEJRGKQBMQTXBL-MRLBHPIUSA-N |
| XLogP | -1.81 |
| TPSA | 173.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|