C12H22N4O4 — CID 57326570
(2R,3R,4R,5R,6S)-5-[4-[(dimethylamino)methyl]triazol-1-yl]-2-(hydroxymethyl)-6-methyloxane-3,4-diol (PubChem CID 57326570) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-[4-[(dimethylamino)methyl]triazol-1-yl]-2-(hydroxymethyl)-6-methyloxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-5-[4-[(dimethylamino)methyl]triazol-1-yl]-2-(hydroxymethyl)-6-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 57326570 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-[4-[(dimethylamino)methyl]triazol-1-yl]-2-(hydroxymethyl)-6-methyloxane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1n1cc(CN(C)C)nn1 |
| InChI | InChI=1S/C12H22N4O4/c1-7-10(12(19)11(18)9(6-17)20-7)16-5-8(13-14-16)4-15(2)3/h5,7,9-12,17-19H,4,6H2,1-3H3/t7-,9+,10-,11-,12+/m0/s1 |
| InChIKey | XZWHERXRTHEXII-KQKFNCTQSA-N |
| XLogP | -1.62 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |