C17H26N6O10 — CID 122203979
(2R,3R,4S,5R)-2-[[1-[[4-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]triazol-2-yl]methyl]triazol-4-yl]methoxy]oxane-3,4,5-triol (PubChem CID 122203979) has the molecular formula C17H26N6O10 and a molecular weight of 474.43 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[[1-[[4-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]triazol-2-yl]methyl]triazol-4-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[[1-[[4-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]triazol-2-yl]methyl]triazol-4-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 122203979 |
| Molecular Formula | C17H26N6O10 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-[[1-[[4-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]triazol-2-yl]methyl]triazol-4-yl]methoxy]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](OCc2cn(Cn3ncc(CO[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)n3)nn2)OC[C@H]1O |
| InChI | InChI=1S/C17H26N6O10/c24-10-5-32-16(14(28)12(10)26)30-3-8-1-18-23(20-8)7-22-2-9(19-21-22)4-31-17-15(29)13(27)11(25)6-33-17/h1-2,10-17,24-29H,3-7H2/t10-,11-,12+,13+,14-,15-,16-,17-/m1/s1 |
| InChIKey | PNJUJOQDVVNFFD-LTLPSTFDSA-N |
| XLogP | -4.71 |
| TPSA | 219.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |