C8H13N3O5 — CID 141367770
(2R,3R,4S,5R)-2-(2H-triazol-4-ylmethoxy)oxane-3,4,5-triol (PubChem CID 141367770) has the molecular formula C8H13N3O5 and a molecular weight of 231.21 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2H-triazol-4-ylmethoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-(2H-triazol-4-ylmethoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 141367770 |
| Molecular Formula | C8H13N3O5 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2H-triazol-4-ylmethoxy)oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](OCc2cn[nH]n2)OC[C@H]1O |
| InChI | InChI=1S/C8H13N3O5/c12-5-3-16-8(7(14)6(5)13)15-2-4-1-9-11-10-4/h1,5-8,12-14H,2-3H2,(H,9,10,11)/t5-,6+,7-,8-/m1/s1 |
| InChIKey | WFDWODIDKIGLBX-ULAWRXDQSA-N |
| XLogP | -2.24 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |