C15H19N3O5 — CID 25011962
(2S,3R,4S,5R)-2-[4-(phenylmethoxymethyl)triazol-1-yl]oxane-3,4,5-triol (PubChem CID 25011962) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[4-(phenylmethoxymethyl)triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[4-(phenylmethoxymethyl)triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 25011962 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2S,3R,4S,5R)-2-[4-(phenylmethoxymethyl)triazol-1-yl]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](n2cc(COCc3ccccc3)nn2)OC[C@H]1O |
| InChI | InChI=1S/C15H19N3O5/c19-12-9-23-15(14(21)13(12)20)18-6-11(16-17-18)8-22-7-10-4-2-1-3-5-10/h1-6,12-15,19-21H,7-9H2/t12-,13+,14-,15+/m1/s1 |
| InChIKey | ASRVZBNKPCMILM-BARDWOONSA-N |
| XLogP | -0.39 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |