C12H15N3O6 — CID 25014090
(2R,3R,4S,5R)-2-[4-(furan-2-yloxymethyl)triazol-1-yl]oxane-3,4,5-triol (PubChem CID 25014090) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-(furan-2-yloxymethyl)triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[4-(furan-2-yloxymethyl)triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 25014090 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-(furan-2-yloxymethyl)triazol-1-yl]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](n2cc(COc3ccco3)nn2)OC[C@H]1O |
| InChI | InChI=1S/C12H15N3O6/c16-8-6-21-12(11(18)10(8)17)15-4-7(13-14-15)5-20-9-2-1-3-19-9/h1-4,8,10-12,16-18H,5-6H2/t8-,10+,11-,12-/m1/s1 |
| InChIKey | UPBSJVOLWCPBPA-SASUGWTJSA-N |
| XLogP | -0.94 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |