C26H26N4O3 — CID 86305814
4-[2-[6-(4-pyridin-3-yltriazol-1-yl)hexoxy]phenyl]benzoic acid (PubChem CID 86305814) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[2-[6-(4-pyridin-3-yltriazol-1-yl)hexoxy]phenyl]benzoic acid.
| Compound Name | 4-[2-[6-(4-pyridin-3-yltriazol-1-yl)hexoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 86305814 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[2-[6-(4-pyridin-3-yltriazol-1-yl)hexoxy]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2OCCCCCCn2cc(-c3cccnc3)nn2)cc1 |
| InChI | InChI=1S/C26H26N4O3/c31-26(32)21-13-11-20(12-14-21)23-9-3-4-10-25(23)33-17-6-2-1-5-16-30-19-24(28-29-30)22-8-7-15-27-18-22/h3-4,7-15,18-19H,1-2,5-6,16-17H2,(H,31,32) |
| InChIKey | USQPVDMLGOJYTG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|