C19H30N4O — CID 123339748
4,4,6,6-tetramethyl-8-(4-pyridin-3-yltriazol-1-yl)octan-1-ol (PubChem CID 123339748) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-8-(4-pyridin-3-yltriazol-1-yl)octan-1-ol.
| Compound Name | 4,4,6,6-tetramethyl-8-(4-pyridin-3-yltriazol-1-yl)octan-1-ol |
|---|---|
| PubChem CID | 123339748 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 4,4,6,6-tetramethyl-8-(4-pyridin-3-yltriazol-1-yl)octan-1-ol |
| SMILES | CC(C)(CCCO)CC(C)(C)CCn1cc(-c2cccnc2)nn1 |
| InChI | InChI=1S/C19H30N4O/c1-18(2,8-6-12-24)15-19(3,4)9-11-23-14-17(21-22-23)16-7-5-10-20-13-16/h5,7,10,13-14,24H,6,8-9,11-12,15H2,1-4H3 |
| InChIKey | ZPVFYQDDFWOLMO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |