C27H31N5S — CID 130240790
N-(2-phenylphenyl)sulfanyl-8-(4-pyridin-3-yltriazol-1-yl)octan-1-amine (PubChem CID 130240790) has the molecular formula C27H31N5S and a molecular weight of 457.65 g/mol. Its IUPAC name is N-(2-phenylphenyl)sulfanyl-8-(4-pyridin-3-yltriazol-1-yl)octan-1-amine.
| Compound Name | N-(2-phenylphenyl)sulfanyl-8-(4-pyridin-3-yltriazol-1-yl)octan-1-amine |
|---|---|
| PubChem CID | 130240790 |
| Molecular Formula | C27H31N5S |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-(2-phenylphenyl)sulfanyl-8-(4-pyridin-3-yltriazol-1-yl)octan-1-amine |
| SMILES | c1ccc(-c2ccccc2SNCCCCCCCCn2cc(-c3cccnc3)nn2)cc1 |
| InChI | InChI=1S/C27H31N5S/c1(2-4-11-20-32-22-26(30-31-32)24-15-12-18-28-21-24)3-10-19-29-33-27-17-9-8-16-25(27)23-13-6-5-7-14-23/h5-9,12-18,21-22,29H,1-4,10-11,19-20H2 |
| InChIKey | WBTGXZQBUQZACG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|