C22H27N5O2 — CID 44820065
N-(2-methoxyphenyl)-8-(4-pyridin-3-yltriazol-1-yl)octanamide (PubChem CID 44820065) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-8-(4-pyridin-3-yltriazol-1-yl)octanamide.
| Compound Name | N-(2-methoxyphenyl)-8-(4-pyridin-3-yltriazol-1-yl)octanamide |
|---|---|
| PubChem CID | 44820065 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-(2-methoxyphenyl)-8-(4-pyridin-3-yltriazol-1-yl)octanamide |
| SMILES | COc1ccccc1NC(=O)CCCCCCCn1cc(-c2cccnc2)nn1 |
| InChI | InChI=1S/C22H27N5O2/c1-29-21-12-7-6-11-19(21)24-22(28)13-5-3-2-4-8-15-27-17-20(25-26-27)18-10-9-14-23-16-18/h6-7,9-12,14,16-17H,2-5,8,13,15H2,1H3,(H,24,28) |
| InChIKey | IZGYSEJCEVQQMX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|