C26H26N4O2 — CID 45483914
(2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate (PubChem CID 45483914) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate.
| Compound Name | (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate |
|---|---|
| PubChem CID | 45483914 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate |
| SMILES | O=C(CCCCCCn1cc(-c2cccnc2)nn1)Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H26N4O2/c31-26(32-25-15-8-7-14-23(25)21-11-4-3-5-12-21)16-6-1-2-9-18-30-20-24(28-29-30)22-13-10-17-27-19-22/h3-5,7-8,10-15,17,19-20H,1-2,6,9,16,18H2 |
| InChIKey | NDUBKCICRWWWIY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|