About (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate
(2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate (PubChem CID 45483914) has the molecular formula C26H26N4O2
and a molecular weight of 426.52 g/mol. Its IUPAC name is (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate.
Molecular Properties
| Compound Name | (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate |
| PubChem CID | 45483914 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate |
| SMILES | O=C(CCCCCCn1cc(-c2cccnc2)nn1)Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H26N4O2/c31-26(32-25-15-8-7-14-23(25)21-11-4-3-5-12-21)16-6-1-2-9-18-30-20-24(28-29-30)22-13-10-17-27-19-22/h3-5,7-8,10-15,17,19-20H,1-2,6,9,16,18H2 |
| InChIKey | NDUBKCICRWWWIY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate?
The IUPAC name of (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate (CID 45483914) is (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate.
What is the SMILES notation for (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate?
The canonical SMILES for (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate is O=C(CCCCCCn1cc(-c2cccnc2)nn1)Oc1ccccc1-c1ccccc1.
What is the InChIKey of (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate?
The InChIKey is NDUBKCICRWWWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N4O2/c31-26(32-25-15-8-7-14-23(25)21-11-4-3-5-12-21)16-6-1-2-9-18-30-20-24(28-29-30)22-13-10-17-27-19-22/h3-5,7-8,10-15,17,19-20H,1-2,6,9,16,18H2.
What are the key properties of (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate?
(2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate has a molecular weight of 426.52 g/mol, XLogP of 5.56, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylphenyl) 7-(4-pyridin-3-yltriazol-1-yl)heptanoate is sourced from PubChem (CID 45483914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).