C51H53N9O2 — CID 160699416
3-[1-[6-(2-phenylphenoxy)hexyl]triazol-4-yl]pyridine;2-phenyl-N-[6-(4-pyridin-3-yltriazol-1-yl)hexyl]benzamide (PubChem CID 160699416) has the molecular formula C51H53N9O2 and a molecular weight of 824.05 g/mol. Its IUPAC name is 3-[1-[6-(2-phenylphenoxy)hexyl]triazol-4-yl]pyridine;2-phenyl-N-[6-(4-pyridin-3-yltriazol-1-yl)hexyl]benzamide.
| Compound Name | 3-[1-[6-(2-phenylphenoxy)hexyl]triazol-4-yl]pyridine;2-phenyl-N-[6-(4-pyridin-3-yltriazol-1-yl)hexyl]benzamide |
|---|---|
| PubChem CID | 160699416 |
| Molecular Formula | C51H53N9O2 |
| Molecular Weight | 824.05 g/mol |
| Exact Mass | 823.43 |
| IUPAC Name | 3-[1-[6-(2-phenylphenoxy)hexyl]triazol-4-yl]pyridine;2-phenyl-N-[6-(4-pyridin-3-yltriazol-1-yl)hexyl]benzamide |
| SMILES | O=C(NCCCCCCn1cc(-c2cccnc2)nn1)c1ccccc1-c1ccccc1.c1ccc(-c2ccccc2OCCCCCCn2cc(-c3cccnc3)nn2)cc1 |
| InChI | InChI=1S/C26H27N5O.C25H26N4O/c32-26(24-15-7-6-14-23(24)21-11-4-3-5-12-21)28-17-8-1-2-9-18-31-20-25(29-30-31)22-13-10-16-27-19-22;1(8-17-29-20-24(27-28-29)22-13-10-16-26-19-22)2-9-18-30-25-15-7-6-14-23(25)21-11-4-3-5-12-21/h3-7,10-16,19-20H,1-2,8-9,17-18H2,(H,28,32);3-7,10-16,19-20H,1-2,8-9,17-18H2 |
| InChIKey | RQKPMVRZUKJWSV-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.05 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|