C28H29N5O3 — CID 86305819
4-[2-[7-(4-pyridin-3-yltriazol-1-yl)heptylcarbamoyl]phenyl]benzoic acid (PubChem CID 86305819) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-[2-[7-(4-pyridin-3-yltriazol-1-yl)heptylcarbamoyl]phenyl]benzoic acid.
| Compound Name | 4-[2-[7-(4-pyridin-3-yltriazol-1-yl)heptylcarbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 86305819 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-[2-[7-(4-pyridin-3-yltriazol-1-yl)heptylcarbamoyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2C(=O)NCCCCCCCn2cc(-c3cccnc3)nn2)cc1 |
| InChI | InChI=1S/C28H29N5O3/c34-27(25-11-5-4-10-24(25)21-12-14-22(15-13-21)28(35)36)30-17-6-2-1-3-7-18-33-20-26(31-32-33)23-9-8-16-29-19-23/h4-5,8-16,19-20H,1-3,6-7,17-18H2,(H,30,34)(H,35,36) |
| InChIKey | HZJZFYBKCUEDTD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|