C30H26N4O — CID 159230522
1-(2-phenylphenyl)-4-[4-[(4-pyridin-3-yltriazol-1-yl)methyl]phenyl]butan-1-one (PubChem CID 159230522) has the molecular formula C30H26N4O and a molecular weight of 458.57 g/mol. Its IUPAC name is 1-(2-phenylphenyl)-4-[4-[(4-pyridin-3-yltriazol-1-yl)methyl]phenyl]butan-1-one.
| Compound Name | 1-(2-phenylphenyl)-4-[4-[(4-pyridin-3-yltriazol-1-yl)methyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 159230522 |
| Molecular Formula | C30H26N4O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-(2-phenylphenyl)-4-[4-[(4-pyridin-3-yltriazol-1-yl)methyl]phenyl]butan-1-one |
| SMILES | O=C(CCCc1ccc(Cn2cc(-c3cccnc3)nn2)cc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C30H26N4O/c35-30(28-13-5-4-12-27(28)25-9-2-1-3-10-25)14-6-8-23-15-17-24(18-16-23)21-34-22-29(32-33-34)26-11-7-19-31-20-26/h1-5,7,9-13,15-20,22H,6,8,14,21H2 |
| InChIKey | KSVMJBRPCUQVHL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |