C23H14N2O2S2 — CID 168655174
[2,5-bis(1,3-benzothiazol-2-yl)phenyl] prop-2-enoate (PubChem CID 168655174) has the molecular formula C23H14N2O2S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is [2,5-bis(1,3-benzothiazol-2-yl)phenyl] prop-2-enoate.
| Compound Name | [2,5-bis(1,3-benzothiazol-2-yl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 168655174 |
| Molecular Formula | C23H14N2O2S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [2,5-bis(1,3-benzothiazol-2-yl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(-c2nc3ccccc3s2)ccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H14N2O2S2/c1-2-21(26)27-18-13-14(22-24-16-7-3-5-9-19(16)28-22)11-12-15(18)23-25-17-8-4-6-10-20(17)29-23/h2-13H,1H2 |
| InChIKey | OLFFRVQLZGCNFK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|