C21H16N2O5S — CID 108738911
methyl 4-(1,3-benzothiazol-2-yl)-5-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-methylfuran-3-carboxylate (PubChem CID 108738911) has the molecular formula C21H16N2O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is methyl 4-(1,3-benzothiazol-2-yl)-5-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 4-(1,3-benzothiazol-2-yl)-5-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108738911 |
| Molecular Formula | C21H16N2O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | methyl 4-(1,3-benzothiazol-2-yl)-5-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)/C=C/c2ccco2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H16N2O5S/c1-12-17(21(25)26-2)18(20-22-14-7-3-4-8-15(14)29-20)19(28-12)23-16(24)10-9-13-6-5-11-27-13/h3-11H,1-2H3,(H,23,24)/b10-9+ |
| InChIKey | XJEOGAJIBMNBGD-MDZDMXLPSA-N |
| XLogP | 4.90 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|