C29H22N2O4S — CID 108761674
methyl 4-(1,3-benzothiazol-2-yl)-5-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-2-methylfuran-3-carboxylate (PubChem CID 108761674) has the molecular formula C29H22N2O4S and a molecular weight of 494.57 g/mol. Its IUPAC name is methyl 4-(1,3-benzothiazol-2-yl)-5-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 4-(1,3-benzothiazol-2-yl)-5-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108761674 |
| Molecular Formula | C29H22N2O4S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | methyl 4-(1,3-benzothiazol-2-yl)-5-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)/C(=C\c2ccccc2)c2ccccc2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H22N2O4S/c1-18-24(29(33)34-2)25(28-30-22-15-9-10-16-23(22)36-28)27(35-18)31-26(32)21(20-13-7-4-8-14-20)17-19-11-5-3-6-12-19/h3-17H,1-2H3,(H,31,32)/b21-17- |
| InChIKey | UODFCBZROBBQST-FXBPSFAMSA-N |
| XLogP | 6.83 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|