C23H16Cl2N2O4S — CID 108761673
methyl 4-(1,3-benzothiazol-2-yl)-5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-2-methylfuran-3-carboxylate (PubChem CID 108761673) has the molecular formula C23H16Cl2N2O4S and a molecular weight of 487.36 g/mol. Its IUPAC name is methyl 4-(1,3-benzothiazol-2-yl)-5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 4-(1,3-benzothiazol-2-yl)-5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108761673 |
| Molecular Formula | C23H16Cl2N2O4S |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | methyl 4-(1,3-benzothiazol-2-yl)-5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)/C=C/c2ccc(Cl)c(Cl)c2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H16Cl2N2O4S/c1-12-19(23(29)30-2)20(22-26-16-5-3-4-6-17(16)32-22)21(31-12)27-18(28)10-8-13-7-9-14(24)15(25)11-13/h3-11H,1-2H3,(H,27,28)/b10-8+ |
| InChIKey | SGRMGLNDOVUPEO-CSKARUKUSA-N |
| XLogP | 6.61 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|