C17H14N2OS — CID 9349652
N-[4-(1,3-benzothiazol-2-yl)phenyl]-2-methylprop-2-enamide (PubChem CID 9349652) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 9349652 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H14N2OS/c1-11(2)16(20)18-13-9-7-12(8-10-13)17-19-14-5-3-4-6-15(14)21-17/h3-10H,1H2,2H3,(H,18,20) |
| InChIKey | MJZBQIYLMYPRRV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|