C27H25N3O2S2 — CID 135775804
(E)-N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 135775804) has the molecular formula C27H25N3O2S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is (E)-N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135775804 |
| Molecular Formula | C27H25N3O2S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (E)-N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=S)NC(=O)/C=C/c2ccc(C(C)C)cc2)cc(-c2nc3ccccc3s2)c1O |
| InChI | InChI=1S/C27H25N3O2S2/c1-16(2)19-11-8-18(9-12-19)10-13-24(31)30-27(33)28-20-14-17(3)25(32)21(15-20)26-29-22-6-4-5-7-23(22)34-26/h4-16,32H,1-3H3,(H2,28,30,31,33)/b13-10+ |
| InChIKey | IOQXUMXRDGBGTM-JLHYYAGUSA-N |
| XLogP | 6.63 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|