C19H14ClNO4 — CID 59654716
2-[3-[[5-(3-chlorophenyl)furan-2-carbonyl]amino]phenyl]acetic acid (PubChem CID 59654716) has the molecular formula C19H14ClNO4 and a molecular weight of 355.78 g/mol. Its IUPAC name is 2-[3-[[5-(3-chlorophenyl)furan-2-carbonyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[5-(3-chlorophenyl)furan-2-carbonyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 59654716 |
| Molecular Formula | C19H14ClNO4 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-[3-[[5-(3-chlorophenyl)furan-2-carbonyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NC(=O)c2ccc(-c3cccc(Cl)c3)o2)c1 |
| InChI | InChI=1S/C19H14ClNO4/c20-14-5-2-4-13(11-14)16-7-8-17(25-16)19(24)21-15-6-1-3-12(9-15)10-18(22)23/h1-9,11H,10H2,(H,21,24)(H,22,23) |
| InChIKey | KXRHYDFMDMYJIA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |