C60H50N2O10 — CID 139185869
bis(N,N-dimethylformamide);4-[4-[1,2,2-tris[4-(4-carboxyphenyl)phenyl]ethenyl]phenyl]benzoic acid (PubChem CID 139185869) has the molecular formula C60H50N2O10 and a molecular weight of 959.06 g/mol. Its IUPAC name is bis(N,N-dimethylformamide);4-[4-[1,2,2-tris[4-(4-carboxyphenyl)phenyl]ethenyl]phenyl]benzoic acid.
| Compound Name | bis(N,N-dimethylformamide);4-[4-[1,2,2-tris[4-(4-carboxyphenyl)phenyl]ethenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 139185869 |
| Molecular Formula | C60H50N2O10 |
| Molecular Weight | 959.06 g/mol |
| Exact Mass | 958.35 |
| IUPAC Name | bis(N,N-dimethylformamide);4-[4-[1,2,2-tris[4-(4-carboxyphenyl)phenyl]ethenyl]phenyl]benzoic acid |
| SMILES | CN(C)C=O.CN(C)C=O.O=C(O)c1ccc(-c2ccc(C(=C(c3ccc(-c4ccc(C(=O)O)cc4)cc3)c3ccc(-c4ccc(C(=O)O)cc4)cc3)c3ccc(-c4ccc(C(=O)O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H36O8.2C3H7NO/c55-51(56)45-25-9-37(10-26-45)33-1-17-41(18-2-33)49(42-19-3-34(4-20-42)38-11-27-46(28-12-38)52(57)58)50(43-21-5-35(6-22-43)39-13-29-47(30-14-39)53(59)60)44-23-7-36(8-24-44)40-15-31-48(32-16-40)54(61)62;2*1-4(2)3-5/h1-32H,(H,55,56)(H,57,58)(H,59,60)(H,61,62);2*3H,1-2H3 |
| InChIKey | QPKNNEQVJITWPY-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.06 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|