C24H20N4O2S — CID 41158629
2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]-N-(2-phenylphenyl)acetamide (PubChem CID 41158629) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 41158629 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]-N-(2-phenylphenyl)acetamide |
| SMILES | O=C(Cc1csc(NC(=O)Nc2ccccc2)n1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H20N4O2S/c29-22(27-21-14-8-7-13-20(21)17-9-3-1-4-10-17)15-19-16-31-24(26-19)28-23(30)25-18-11-5-2-6-12-18/h1-14,16H,15H2,(H,27,29)(H2,25,26,28,30) |
| InChIKey | XWOQGEGAMBZHSQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |