C22H21ClFN3O3S — CID 55896945
N-[4-[2-[3-(4-chlorophenoxy)propyl-methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-fluorobenzamide (PubChem CID 55896945) has the molecular formula C22H21ClFN3O3S and a molecular weight of 461.95 g/mol. Its IUPAC name is N-[4-[2-[3-(4-chlorophenoxy)propyl-methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-fluorobenzamide.
| Compound Name | N-[4-[2-[3-(4-chlorophenoxy)propyl-methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 55896945 |
| Molecular Formula | C22H21ClFN3O3S |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[4-[2-[3-(4-chlorophenoxy)propyl-methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-fluorobenzamide |
| SMILES | CN(CCCOc1ccc(Cl)cc1)C(=O)Cc1csc(NC(=O)c2ccccc2F)n1 |
| InChI | InChI=1S/C22H21ClFN3O3S/c1-27(11-4-12-30-17-9-7-15(23)8-10-17)20(28)13-16-14-31-22(25-16)26-21(29)18-5-2-3-6-19(18)24/h2-3,5-10,14H,4,11-13H2,1H3,(H,25,26,29) |
| InChIKey | ZKMIMLPKUIQTQQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|