C22H22ClN3O3S — CID 55896812
N-[4-[2-[3-(4-chlorophenoxy)propyl-methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 55896812) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is N-[4-[2-[3-(4-chlorophenoxy)propyl-methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-[3-(4-chlorophenoxy)propyl-methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 55896812 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-[4-[2-[3-(4-chlorophenoxy)propyl-methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CN(CCCOc1ccc(Cl)cc1)C(=O)Cc1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C22H22ClN3O3S/c1-26(12-5-13-29-19-10-8-17(23)9-11-19)20(27)14-18-15-30-22(24-18)25-21(28)16-6-3-2-4-7-16/h2-4,6-11,15H,5,12-14H2,1H3,(H,24,25,28) |
| InChIKey | JIIRAZYTRBZPRM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|