C17H15N3O2S — CID 805078
N-[5-(phenoxymethyl)-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 805078) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[5-(phenoxymethyl)-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-(phenoxymethyl)-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 805078 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[5-(phenoxymethyl)-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1nnc(COc2ccccc2)s1 |
| InChI | InChI=1S/C17H15N3O2S/c21-15(11-13-7-3-1-4-8-13)18-17-20-19-16(23-17)12-22-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,18,20,21) |
| InChIKey | BFPANJLQEXOAAY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |