C21H24N2OS — CID 118726195
N-(5-benzyl-1,3-thiazol-2-yl)adamantane-1-carboxamide (PubChem CID 118726195) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)adamantane-1-carboxamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118726195 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2ccccc2)s1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H24N2OS/c24-19(21-10-15-6-16(11-21)8-17(7-15)12-21)23-20-22-13-18(25-20)9-14-4-2-1-3-5-14/h1-5,13,15-17H,6-12H2,(H,22,23,24) |
| InChIKey | XLYHRRWHFJBRAU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |