C19H16Br2N2OS — CID 17015927
2-bromo-N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-3-phenylpropanamide (PubChem CID 17015927) has the molecular formula C19H16Br2N2OS and a molecular weight of 480.23 g/mol. Its IUPAC name is 2-bromo-N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-3-phenylpropanamide.
| Compound Name | 2-bromo-N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 17015927 |
| Molecular Formula | C19H16Br2N2OS |
| Molecular Weight | 480.23 g/mol |
| Exact Mass | 477.94 |
| IUPAC Name | 2-bromo-N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-3-phenylpropanamide |
| SMILES | O=C(Nc1ncc(Cc2ccc(Br)cc2)s1)C(Br)Cc1ccccc1 |
| InChI | InChI=1S/C19H16Br2N2OS/c20-15-8-6-14(7-9-15)10-16-12-22-19(25-16)23-18(24)17(21)11-13-4-2-1-3-5-13/h1-9,12,17H,10-11H2,(H,22,23,24) |
| InChIKey | CMLJHXNCPGCMTC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.23 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|