C19H22N2OS — CID 16550294
N-(5-benzyl-1,3-thiazol-2-yl)-2-(2-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 16550294) has the molecular formula C19H22N2OS and a molecular weight of 326.46 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-2-(2-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(2-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 16550294 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(2-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | O=C(CC1CC2CCC1C2)Nc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C19H22N2OS/c22-18(11-16-9-14-6-7-15(16)8-14)21-19-20-12-17(23-19)10-13-4-2-1-3-5-13/h1-5,12,14-16H,6-11H2,(H,20,21,22) |
| InChIKey | OVMJVEYRTPMXDQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |