C19H21ClN2OS — CID 7915348
(5S,7R)-3-chloro-N-(2-methyl-1,3-benzothiazol-6-yl)adamantane-1-carboxamide (PubChem CID 7915348) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-(2-methyl-1,3-benzothiazol-6-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-(2-methyl-1,3-benzothiazol-6-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7915348 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (5S,7R)-3-chloro-N-(2-methyl-1,3-benzothiazol-6-yl)adamantane-1-carboxamide |
| SMILES | Cc1nc2ccc(NC(=O)C34C[C@@H]5C[C@@H](CC(Cl)(C5)C3)C4)cc2s1 |
| InChI | InChI=1S/C19H21ClN2OS/c1-11-21-15-3-2-14(5-16(15)24-11)22-17(23)18-6-12-4-13(7-18)9-19(20,8-12)10-18/h2-3,5,12-13H,4,6-10H2,1H3,(H,22,23)/t12-,13+,18?,19? |
| InChIKey | XMGHRDFWKDMFQM-NFAYLAGKSA-N |
| XLogP | 5.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|