C18H18ClFN2OS — CID 98280516
(5S,7S)-3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)adamantane-1-carboxamide (PubChem CID 98280516) has the molecular formula C18H18ClFN2OS and a molecular weight of 364.87 g/mol. Its IUPAC name is (5S,7S)-3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98280516 |
| Molecular Formula | C18H18ClFN2OS |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (5S,7S)-3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc(F)cc2s1)C12C[C@@H]3C[C@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C18H18ClFN2OS/c19-18-7-10-3-11(8-18)6-17(5-10,9-18)15(23)22-16-21-13-2-1-12(20)4-14(13)24-16/h1-2,4,10-11H,3,5-9H2,(H,21,22,23)/t10-,11-,17?,18?/m0/s1 |
| InChIKey | IGWZYGORVAHPBY-DDCRILKWSA-N |
| XLogP | 4.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|