C24H20ClN3O4S — CID 55787078
N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-1-methyl-2-oxoquinoline-4-carboxamide (PubChem CID 55787078) has the molecular formula C24H20ClN3O4S and a molecular weight of 481.96 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-1-methyl-2-oxoquinoline-4-carboxamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-1-methyl-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55787078 |
| Molecular Formula | C24H20ClN3O4S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-1-methyl-2-oxoquinoline-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(=O)n(C)c3ccccc23)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H20ClN3O4S/c1-15-11-12-16(13-22(15)33(31,32)27-20-9-5-4-8-19(20)25)26-24(30)18-14-23(29)28(2)21-10-6-3-7-17(18)21/h3-14,27H,1-2H3,(H,26,30) |
| InChIKey | XFYWMUQAYFUQRC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |