C25H23N3O5S — CID 55786897
N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-1-methyl-2-oxoquinoline-4-carboxamide (PubChem CID 55786897) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-1-methyl-2-oxoquinoline-4-carboxamide.
| Compound Name | N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-1-methyl-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55786897 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-1-methyl-2-oxoquinoline-4-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3cc(=O)n(C)c4ccccc34)ccc2C)cc1 |
| InChI | InChI=1S/C25H23N3O5S/c1-16-8-9-18(14-23(16)34(31,32)27-17-10-12-19(33-3)13-11-17)26-25(30)21-15-24(29)28(2)22-7-5-4-6-20(21)22/h4-15,27H,1-3H3,(H,26,30) |
| InChIKey | CVGQDVJZHXRVSZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |