C14H11N3OS — CID 62900750
N-(6-amino-3-pyridinyl)-1-benzothiophene-2-carboxamide (PubChem CID 62900750) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(6-amino-3-pyridinyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 62900750 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2cc3ccccc3s2)cn1 |
| InChI | InChI=1S/C14H11N3OS/c15-13-6-5-10(8-16-13)17-14(18)12-7-9-3-1-2-4-11(9)19-12/h1-8H,(H2,15,16)(H,17,18) |
| InChIKey | VLNKPEDZRYYYGE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |