C23H22FN3O4S — CID 1446050
(3S)-N'-(4-fluorobenzoyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carbohydrazide (PubChem CID 1446050) has the molecular formula C23H22FN3O4S and a molecular weight of 455.51 g/mol. Its IUPAC name is (3S)-N'-(4-fluorobenzoyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carbohydrazide.
| Compound Name | (3S)-N'-(4-fluorobenzoyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 1446050 |
| Molecular Formula | C23H22FN3O4S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (3S)-N'-(4-fluorobenzoyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@H]1CCCN(S(=O)(=O)c2ccc3ccccc3c2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3O4S/c24-20-10-7-17(8-11-20)22(28)25-26-23(29)19-6-3-13-27(15-19)32(30,31)21-12-9-16-4-1-2-5-18(16)14-21/h1-2,4-5,7-12,14,19H,3,6,13,15H2,(H,25,28)(H,26,29)/t19-/m0/s1 |
| InChIKey | XKIGXSKTSDKSFP-IBGZPJMESA-N |
| XLogP | 2.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|