C23H20F4N2O3S — CID 43872886
N-[4-fluoro-3-(trifluoromethyl)phenyl]-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 43872886) has the molecular formula C23H20F4N2O3S and a molecular weight of 480.48 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43872886 |
| Molecular Formula | C23H20F4N2O3S |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(C(F)(F)F)c1)C1CCCN(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C23H20F4N2O3S/c24-21-10-8-18(13-20(21)23(25,26)27)28-22(30)17-6-3-11-29(14-17)33(31,32)19-9-7-15-4-1-2-5-16(15)12-19/h1-2,4-5,7-10,12-13,17H,3,6,11,14H2,(H,28,30) |
| InChIKey | SMROUZFYGAMFPL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |