C20H14BrClN2O4S — CID 60581027
(2-bromo-3-pyridinyl) 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 60581027) has the molecular formula C20H14BrClN2O4S and a molecular weight of 493.77 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl) 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | (2-bromo-3-pyridinyl) 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 60581027 |
| Molecular Formula | C20H14BrClN2O4S |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | (2-bromo-3-pyridinyl) 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | O=C(Oc1cccnc1Br)c1ccc(Cl)c(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C20H14BrClN2O4S/c21-19-17(6-3-10-23-19)28-20(25)14-7-8-15(22)18(12-14)29(26,27)24-11-9-13-4-1-2-5-16(13)24/h1-8,10,12H,9,11H2 |
| InChIKey | YEPYBNMXWRMFSM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|