C23H19ClN2O5S — CID 55498688
(2-amino-2-oxo-1-phenylethyl) 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 55498688) has the molecular formula C23H19ClN2O5S and a molecular weight of 470.93 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 55498688 |
| Molecular Formula | C23H19ClN2O5S |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | NC(=O)C(OC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCc3ccccc32)c1)c1ccccc1 |
| InChI | InChI=1S/C23H19ClN2O5S/c24-18-11-10-17(23(28)31-21(22(25)27)16-7-2-1-3-8-16)14-20(18)32(29,30)26-13-12-15-6-4-5-9-19(15)26/h1-11,14,21H,12-13H2,(H2,25,27) |
| InChIKey | KMWFRKBOMIGEOH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |