C23H21NO5S — CID 4527658
phenyl 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-4-methoxybenzoate (PubChem CID 4527658) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is phenyl 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-4-methoxybenzoate.
| Compound Name | phenyl 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 4527658 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | phenyl 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2)cc1S(=O)(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C23H21NO5S/c1-28-21-14-13-18(23(25)29-19-10-3-2-4-11-19)16-22(21)30(26,27)24-15-7-9-17-8-5-6-12-20(17)24/h2-6,8,10-14,16H,7,9,15H2,1H3 |
| InChIKey | ZRXVLELKGDLMKU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|